About 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine
4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine (PubChem CID 156637602) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine.
Analyze 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine?
The IUPAC name of 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine (CID 156637602) is 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine.
What is the SMILES notation for 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine?
The canonical SMILES for 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine is CC1=CC2=C(CC1)OCCN(C)C2.
What is the InChIKey of 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine?
The InChIKey is MJGCOEMUGPOXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-9-3-4-11-10(7-9)8-12(2)5-6-13-11/h7H,3-6,8H2,1-2H3.
What are the key properties of 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine?
4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine has a molecular weight of 179.26 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-3,5,8,9-tetrahydro-2H-1,4-benzoxazepine is sourced from PubChem (CID 156637602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).