C13H23NO — CID 91473026
N-ethyl-N-methyl-3-(4-methylcyclohexa-1,3-dien-1-yl)oxypropan-1-amine (PubChem CID 91473026) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-(4-methylcyclohexa-1,3-dien-1-yl)oxypropan-1-amine.
| Compound Name | N-ethyl-N-methyl-3-(4-methylcyclohexa-1,3-dien-1-yl)oxypropan-1-amine |
|---|---|
| PubChem CID | 91473026 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-ethyl-N-methyl-3-(4-methylcyclohexa-1,3-dien-1-yl)oxypropan-1-amine |
| SMILES | CCN(C)CCCOC1=CC=C(C)CC1 |
| InChI | InChI=1S/C13H23NO/c1-4-14(3)10-5-11-15-13-8-6-12(2)7-9-13/h6,8H,4-5,7,9-11H2,1-3H3 |
| InChIKey | ZLZGFYYDOQCYDX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|