C15H12F2N4O3 — CID 156642677
methyl 4,5-difluoro-2-[(2-imino-1-methanimidoylpyridine-3-carbonyl)amino]benzoate (PubChem CID 156642677) has the molecular formula C15H12F2N4O3 and a molecular weight of 334.28 g/mol. Its IUPAC name is methyl 4,5-difluoro-2-[(2-imino-1-methanimidoylpyridine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4,5-difluoro-2-[(2-imino-1-methanimidoylpyridine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 156642677 |
| Molecular Formula | C15H12F2N4O3 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 4,5-difluoro-2-[(2-imino-1-methanimidoylpyridine-3-carbonyl)amino]benzoate |
| SMILES | [H]/N=c1/c(C(=O)Nc2cc(F)c(F)cc2C(=O)OC)cccn1/C=N/[H] |
| InChI | InChI=1S/C15H12F2N4O3/c1-24-15(23)9-5-10(16)11(17)6-12(9)20-14(22)8-3-2-4-21(7-18)13(8)19/h2-7,18-19H,1H3,(H,20,22)/b18-7+,19-13- |
| InChIKey | GFRPXDMJYCYXIS-XZBKOULESA-N |
| XLogP | 1.74 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|