C33H42N4O10PS+ — CID 156642845
[[2-[3-amino-4-[(E)-3-pyridin-2-ylprop-2-enimidoyl]phenyl]sulfanylbenzoyl]-methylamino]methyl-oxo-(propan-2-yloxycarbonyloxymethoxy)phosphanium;hydroxymethyl propan-2-yl carbonate;molecular hydrogen (PubChem CID 156642845) has the molecular formula C33H42N4O10PS+ and a molecular weight of 717.76 g/mol. Its IUPAC name is [[2-[3-amino-4-[(E)-3-pyridin-2-ylprop-2-enimidoyl]phenyl]sulfanylbenzoyl]-methylamino]methyl-oxo-(propan-2-yloxycarbonyloxymethoxy)phosphanium;hydroxymethyl propan-2-yl carbonate;molecular hydrogen.
| Compound Name | [[2-[3-amino-4-[(E)-3-pyridin-2-ylprop-2-enimidoyl]phenyl]sulfanylbenzoyl]-methylamino]methyl-oxo-(propan-2-yloxycarbonyloxymethoxy)phosphanium;hydroxymethyl propan-2-yl carbonate;molecular hydrogen |
|---|---|
| PubChem CID | 156642845 |
| Molecular Formula | C33H42N4O10PS+ |
| Molecular Weight | 717.76 g/mol |
| Exact Mass | 717.24 |
| IUPAC Name | [[2-[3-amino-4-[(E)-3-pyridin-2-ylprop-2-enimidoyl]phenyl]sulfanylbenzoyl]-methylamino]methyl-oxo-(propan-2-yloxycarbonyloxymethoxy)phosphanium;hydroxymethyl propan-2-yl carbonate;molecular hydrogen |
| SMILES | CC(C)OC(=O)OCO.[H]/N=C(\C=C\c1ccccn1)c1ccc(Sc2ccccc2C(=O)N(C)C[P+](=O)OCOC(=O)OC(C)C)cc1N.[H][H] |
| InChI | InChI=1S/C28H30N4O6PS.C5H10O4.H2/c1-19(2)38-28(34)36-18-37-39(35)17-32(3)27(33)23-9-4-5-10-26(23)40-21-12-13-22(25(30)16-21)24(29)14-11-20-8-6-7-15-31-20;1-4(2)9-5(7)8-3-6;/h4-16,19,29H,17-18,30H2,1-3H3;4,6H,3H2,1-2H3;1H/q+1;;/b14-11+,29-24+;; |
| InChIKey | SUCJQHXJTVMLFF-WZDZTMCJSA-N |
| XLogP | 6.95 |
| TPSA | 200.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|