C37H40N5O4PS2 — CID 156642872
cyclohexyl 2-[[[5-[2-(methylcarbamoyl)phenyl]sulfanyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]anilino]-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 156642872) has the molecular formula C37H40N5O4PS2 and a molecular weight of 713.87 g/mol. Its IUPAC name is cyclohexyl 2-[[[5-[2-(methylcarbamoyl)phenyl]sulfanyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]anilino]-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[5-[2-(methylcarbamoyl)phenyl]sulfanyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]anilino]-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 156642872 |
| Molecular Formula | C37H40N5O4PS2 |
| Molecular Weight | 713.87 g/mol |
| Exact Mass | 713.23 |
| IUPAC Name | cyclohexyl 2-[[[5-[2-(methylcarbamoyl)phenyl]sulfanyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]anilino]-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | [H]/N=C(\C=C\c1ccccn1)c1ccc(Sc2ccccc2C(=O)NC)cc1NP(=S)(NC(C)C(=O)OC1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C37H40N5O4PS2/c1-26(37(44)45-28-14-5-3-6-15-28)41-47(48,46-29-16-7-4-8-17-29)42-34-25-30(49-35-19-10-9-18-32(35)36(43)39-2)21-22-31(34)33(38)23-20-27-13-11-12-24-40-27/h4,7-13,16-26,28,38H,3,5-6,14-15H2,1-2H3,(H,39,43)(H2,41,42,48)/b23-20+,38-33+ |
| InChIKey | LHFBUWMKRANHLL-ZSPWIWHZSA-N |
| XLogP | 8.24 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.87 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|