C16H17N3 — CID 156809772
N,5-dimethyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline (PubChem CID 156809772) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N,5-dimethyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline.
| Compound Name | N,5-dimethyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline |
|---|---|
| PubChem CID | 156809772 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N,5-dimethyl-2-[(E)-3-pyridin-2-ylprop-2-enimidoyl]aniline |
| SMILES | [H]/N=C(\C=C\c1ccccn1)c1ccc(C)cc1NC |
| InChI | InChI=1S/C16H17N3/c1-12-6-8-14(16(11-12)18-2)15(17)9-7-13-5-3-4-10-19-13/h3-11,17-18H,1-2H3/b9-7+,17-15+ |
| InChIKey | OERQEIFANOJKAT-YAMIPUGFSA-N |
| XLogP | 3.51 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|