C22H27FO5 — CID 156644400
ethyl (E)-5-[4-(3-fluoro-4-hydroxyphenyl)-1-(hydroxymethyl)-3-oxabicyclo[3.3.1]non-6-en-6-yl]pent-2-enoate (PubChem CID 156644400) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is ethyl (E)-5-[4-(3-fluoro-4-hydroxyphenyl)-1-(hydroxymethyl)-3-oxabicyclo[3.3.1]non-6-en-6-yl]pent-2-enoate.
| Compound Name | ethyl (E)-5-[4-(3-fluoro-4-hydroxyphenyl)-1-(hydroxymethyl)-3-oxabicyclo[3.3.1]non-6-en-6-yl]pent-2-enoate |
|---|---|
| PubChem CID | 156644400 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl (E)-5-[4-(3-fluoro-4-hydroxyphenyl)-1-(hydroxymethyl)-3-oxabicyclo[3.3.1]non-6-en-6-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/CCC1=CCC2(CO)COC(c3ccc(O)c(F)c3)C1C2 |
| InChI | InChI=1S/C22H27FO5/c1-2-27-20(26)6-4-3-5-15-9-10-22(13-24)12-17(15)21(28-14-22)16-7-8-19(25)18(23)11-16/h4,6-9,11,17,21,24-25H,2-3,5,10,12-14H2,1H3/b6-4+ |
| InChIKey | MKQKZQIKALOJBT-GQCTYLIASA-N |
| XLogP | 3.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|