C14H11Br2IN4 — CID 156645913
3-(2,4-dibromo-N-iodoanilino)-N'-methanimidoylbenzenecarboximidamide (PubChem CID 156645913) has the molecular formula C14H11Br2IN4 and a molecular weight of 521.98 g/mol. Its IUPAC name is 3-(2,4-dibromo-N-iodoanilino)-N'-methanimidoylbenzenecarboximidamide.
| Compound Name | 3-(2,4-dibromo-N-iodoanilino)-N'-methanimidoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 156645913 |
| Molecular Formula | C14H11Br2IN4 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 519.84 |
| IUPAC Name | 3-(2,4-dibromo-N-iodoanilino)-N'-methanimidoylbenzenecarboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1cccc(N(I)c2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H11Br2IN4/c15-10-4-5-13(12(16)7-10)21(17)11-3-1-2-9(6-11)14(19)20-8-18/h1-8H,(H3,18,19,20) |
| InChIKey | JDFOXSZMGKJILO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|