C53H36N6O2 — CID 156646879
2-[8-[3-(1-methyl-4,6-diphenyl-2H-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-6,8-diphenylpyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 156646879) has the molecular formula C53H36N6O2 and a molecular weight of 788.91 g/mol. Its IUPAC name is 2-[8-[3-(1-methyl-4,6-diphenyl-2H-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-6,8-diphenylpyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-[8-[3-(1-methyl-4,6-diphenyl-2H-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-6,8-diphenylpyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 156646879 |
| Molecular Formula | C53H36N6O2 |
| Molecular Weight | 788.91 g/mol |
| Exact Mass | 788.29 |
| IUPAC Name | 2-[8-[3-(1-methyl-4,6-diphenyl-2H-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-6,8-diphenylpyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | CN1C(c2ccccc2)=NC(c2ccccc2)=NC1c1cccc(-c2ccc3oc4cccc(-c5nc(=O)n6c(-c7ccccc7)cc(-c7ccccc7)cc6n5)c4c3c2)c1 |
| InChI | InChI=1S/C53H36N6O2/c1-58-51(37-22-12-5-13-23-37)55-49(36-20-10-4-11-21-36)56-52(58)40-25-14-24-38(30-40)39-28-29-45-43(31-39)48-42(26-15-27-46(48)61-45)50-54-47-33-41(34-16-6-2-7-17-34)32-44(59(47)53(60)57-50)35-18-8-3-9-19-35/h2-33,52H,1H3 |
| InChIKey | UVFDZHABVORFQU-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.91 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |