C28H32OS — CID 156649368
tert-butyl-diphenyl-(4-phenylcyclohex-3-en-1-yl)oxy-λ4-sulfane (PubChem CID 156649368) has the molecular formula C28H32OS and a molecular weight of 416.63 g/mol. Its IUPAC name is tert-butyl-diphenyl-(4-phenylcyclohex-3-en-1-yl)oxy-λ4-sulfane.
| Compound Name | tert-butyl-diphenyl-(4-phenylcyclohex-3-en-1-yl)oxy-λ4-sulfane |
|---|---|
| PubChem CID | 156649368 |
| Molecular Formula | C28H32OS |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | tert-butyl-diphenyl-(4-phenylcyclohex-3-en-1-yl)oxy-λ4-sulfane |
| SMILES | CC(C)(C)S(OC1CC=C(c2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32OS/c1-28(2,3)30(26-15-9-5-10-16-26,27-17-11-6-12-18-27)29-25-21-19-24(20-22-25)23-13-7-4-8-14-23/h4-19,25H,20-22H2,1-3H3 |
| InChIKey | YYZLBXNYOYWYQH-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |