C10H16N2 — CID 156649479
N-methyl-3,4,5,6-tetrahydro-1H-isoquinolin-2-amine (PubChem CID 156649479) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-methyl-3,4,5,6-tetrahydro-1H-isoquinolin-2-amine.
| Compound Name | N-methyl-3,4,5,6-tetrahydro-1H-isoquinolin-2-amine |
|---|---|
| PubChem CID | 156649479 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-methyl-3,4,5,6-tetrahydro-1H-isoquinolin-2-amine |
| SMILES | CNN1CCC2=C(C=CCC2)C1 |
| InChI | InChI=1S/C10H16N2/c1-11-12-7-6-9-4-2-3-5-10(9)8-12/h3,5,11H,2,4,6-8H2,1H3 |
| InChIKey | ZFYZXCJOUXQGOO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |