C9H18N2 — CID 101195809
2-(cyclohexen-1-ylmethyl)-1,1-dimethylhydrazine (PubChem CID 101195809) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-(cyclohexen-1-ylmethyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(cyclohexen-1-ylmethyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 101195809 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-(cyclohexen-1-ylmethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCC1=CCCCC1 |
| InChI | InChI=1S/C9H18N2/c1-11(2)10-8-9-6-4-3-5-7-9/h6,10H,3-5,7-8H2,1-2H3 |
| InChIKey | PTUHLQDIBJRNJX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|