C32H45BN4O6 — CID 156652453
tert-butyl 4-[[6-[(dimethylamino)methyl]-5-(oxan-4-yl)-2-pyridinyl]amino]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindole-2-carboxylate (PubChem CID 156652453) has the molecular formula C32H45BN4O6 and a molecular weight of 592.55 g/mol. Its IUPAC name is tert-butyl 4-[[6-[(dimethylamino)methyl]-5-(oxan-4-yl)-2-pyridinyl]amino]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 4-[[6-[(dimethylamino)methyl]-5-(oxan-4-yl)-2-pyridinyl]amino]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 156652453 |
| Molecular Formula | C32H45BN4O6 |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | tert-butyl 4-[[6-[(dimethylamino)methyl]-5-(oxan-4-yl)-2-pyridinyl]amino]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindole-2-carboxylate |
| SMILES | CN(C)Cc1nc(Nc2ccc(B3OC(C)(C)C(C)(C)O3)c3c2C(=O)N(C(=O)OC(C)(C)C)C3)ccc1C1CCOCC1 |
| InChI | InChI=1S/C32H45BN4O6/c1-30(2,3)41-29(39)37-18-22-23(33-42-31(4,5)32(6,7)43-33)11-12-24(27(22)28(37)38)34-26-13-10-21(20-14-16-40-17-15-20)25(35-26)19-36(8)9/h10-13,20H,14-19H2,1-9H3,(H,34,35) |
| InChIKey | WJDIHMRGARBSJB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|