C33H45BN4O7 — CID 167432933
tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-4-yl]amino]-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate (PubChem CID 167432933) has the molecular formula C33H45BN4O7 and a molecular weight of 620.56 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-4-yl]amino]-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-4-yl]amino]-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 167432933 |
| Molecular Formula | C33H45BN4O7 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-4-yl]amino]-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(Nc3ccc(B4OC(C)(C)C(C)(C)O4)c4c3C(=O)N(C(=O)OC(C)(C)C)C4)nc2CC1 |
| InChI | InChI=1S/C33H45BN4O7/c1-30(2,3)42-28(40)37-17-15-20-11-14-25(35-23(20)16-18-37)36-24-13-12-22(34-44-32(7,8)33(9,10)45-34)21-19-38(27(39)26(21)24)29(41)43-31(4,5)6/h11-14H,15-19H2,1-10H3,(H,35,36) |
| InChIKey | FSUXCWMNEVUCEG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|