C59H43IrN3SSi-2 — CID 156659114
CID 156659114 (PubChem CID 156659114) has the molecular formula C59H43IrN3SSi-2 and a molecular weight of 1046.38 g/mol.
| Compound Name | CID 156659114 |
|---|---|
| PubChem CID | 156659114 |
| Molecular Formula | C59H43IrN3SSi-2 |
| Molecular Weight | 1046.38 g/mol |
| Exact Mass | 1046.26 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1cc2sc3cc4ccc5ccccc5c4cc3c2cc1-c1nc2ccccc2n1-c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C45H27N2S.C14H16NSi.Ir/c1-3-12-29(13-4-1)35-18-11-19-36(30-14-5-2-6-15-30)44(35)47-41-21-10-9-20-40(41)46-45(47)33-24-25-42-38(26-33)39-28-37-32(27-43(39)48-42)23-22-31-16-7-8-17-34(31)37;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h1-23,25-28H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KXDIWUOHXOYEQW-UHFFFAOYSA-N |
| XLogP | 15.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.38 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|