C44H41IrN3OSi-2 — CID 156660715
2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;[5-(1,1-dideuterio-2-methylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 156660715) has the molecular formula C44H41IrN3OSi-2 and a molecular weight of 853.17 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;[5-(1,1-dideuterio-2-methylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;[5-(1,1-dideuterio-2-methylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156660715 |
| Molecular Formula | C44H41IrN3OSi-2 |
| Molecular Weight | 853.17 g/mol |
| Exact Mass | 853.30 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;[5-(1,1-dideuterio-2-methylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | [2H]C([2H])([2H])c1nc(-c2[c-]cccc2)c(C([2H])([2H])C(C)C)cc1[Si](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H15N2O.C19H26NSi.Ir/c1-2-9-17(10-3-1)27-22-15-6-5-14-21(22)26-25(27)20-13-8-12-19-18-11-4-7-16-23(18)28-24(19)20;1-14(2)12-17-13-18(21(4,5)6)15(3)20-19(17)16-10-8-7-9-11-16;/h1-12,14-16H;7-10,13-14H,12H2,1-6H3;/q2*-1;/i;3D3,12D2; |
| InChIKey | VLKIYLYWUYPKON-QTVRTZSRSA-N |
| XLogP | 10.99 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.17 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|