C10H17O3S2- — CID 156663628
1-(2-bicyclo[2.2.1]heptanylsulfanyl)propane-2-sulfonate (PubChem CID 156663628) has the molecular formula C10H17O3S2- and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanylsulfanyl)propane-2-sulfonate.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanylsulfanyl)propane-2-sulfonate |
|---|---|
| PubChem CID | 156663628 |
| Molecular Formula | C10H17O3S2- |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanylsulfanyl)propane-2-sulfonate |
| SMILES | CC(CSC1CC2CCC1C2)S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H18O3S2/c1-7(15(11,12)13)6-14-10-5-8-2-3-9(10)4-8/h7-10H,2-6H2,1H3,(H,11,12,13)/p-1 |
| InChIKey | GDJCTCPJPLHUHS-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|