C10H18O2S — CID 98304426
(1R,2R,4R)-2-propan-2-ylsulfonylbicyclo[2.2.1]heptane (PubChem CID 98304426) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (1R,2R,4R)-2-propan-2-ylsulfonylbicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-propan-2-ylsulfonylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 98304426 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1R,2R,4R)-2-propan-2-ylsulfonylbicyclo[2.2.1]heptane |
| SMILES | CC(C)S(=O)(=O)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C10H18O2S/c1-7(2)13(11,12)10-6-8-3-4-9(10)5-8/h7-10H,3-6H2,1-2H3/t8-,9-,10-/m1/s1 |
| InChIKey | WGYVIEAFDYJBIC-OPRDCNLKSA-N |
| XLogP | 2.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |