C47H43NOSi — CID 156675937
[4-(4-tert-butyl-2,6-diphenylphenyl)-2-(4-methyldibenzofuran-2-yl)quinolin-6-yl]-trimethylsilane (PubChem CID 156675937) has the molecular formula C47H43NOSi and a molecular weight of 665.95 g/mol. Its IUPAC name is [4-(4-tert-butyl-2,6-diphenylphenyl)-2-(4-methyldibenzofuran-2-yl)quinolin-6-yl]-trimethylsilane.
| Compound Name | [4-(4-tert-butyl-2,6-diphenylphenyl)-2-(4-methyldibenzofuran-2-yl)quinolin-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 156675937 |
| Molecular Formula | C47H43NOSi |
| Molecular Weight | 665.95 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | [4-(4-tert-butyl-2,6-diphenylphenyl)-2-(4-methyldibenzofuran-2-yl)quinolin-6-yl]-trimethylsilane |
| SMILES | Cc1cc(-c2cc(-c3c(-c4ccccc4)cc(C(C)(C)C)cc3-c3ccccc3)c3cc([Si](C)(C)C)ccc3n2)cc2c1oc1ccccc12 |
| InChI | InChI=1S/C47H43NOSi/c1-30-24-33(25-41-36-20-14-15-21-44(36)49-46(30)41)43-29-40(39-28-35(50(5,6)7)22-23-42(39)48-43)45-37(31-16-10-8-11-17-31)26-34(47(2,3)4)27-38(45)32-18-12-9-13-19-32/h8-29H,1-7H3 |
| InChIKey | LJTNNSJJJJJMRJ-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.95 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|