C49H44N2O — CID 167382084
4-[3,5-bis(4-tert-butylphenyl)-4-methylphenyl]-6-dibenzofuran-3-yl-2-phenylpyrimidine (PubChem CID 167382084) has the molecular formula C49H44N2O and a molecular weight of 676.90 g/mol. Its IUPAC name is 4-[3,5-bis(4-tert-butylphenyl)-4-methylphenyl]-6-dibenzofuran-3-yl-2-phenylpyrimidine.
| Compound Name | 4-[3,5-bis(4-tert-butylphenyl)-4-methylphenyl]-6-dibenzofuran-3-yl-2-phenylpyrimidine |
|---|---|
| PubChem CID | 167382084 |
| Molecular Formula | C49H44N2O |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | 4-[3,5-bis(4-tert-butylphenyl)-4-methylphenyl]-6-dibenzofuran-3-yl-2-phenylpyrimidine |
| SMILES | Cc1c(-c2ccc(C(C)(C)C)cc2)cc(-c2cc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccccc3)n2)cc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C49H44N2O/c1-31-41(32-17-22-37(23-18-32)48(2,3)4)27-36(28-42(31)33-19-24-38(25-20-33)49(5,6)7)44-30-43(50-47(51-44)34-13-9-8-10-14-34)35-21-26-40-39-15-11-12-16-45(39)52-46(40)29-35/h8-30H,1-7H3 |
| InChIKey | XYSSQQUPKTZQQW-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |