C41H26N3Pt- — CID 156677889
3-[9-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-phenyl-2H-carbazol-2-ide;platinum (PubChem CID 156677889) has the molecular formula C41H26N3Pt- and a molecular weight of 755.76 g/mol. Its IUPAC name is 3-[9-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-phenyl-2H-carbazol-2-ide;platinum.
| Compound Name | 3-[9-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-phenyl-2H-carbazol-2-ide;platinum |
|---|---|
| PubChem CID | 156677889 |
| Molecular Formula | C41H26N3Pt- |
| Molecular Weight | 755.76 g/mol |
| Exact Mass | 755.18 |
| IUPAC Name | 3-[9-[3-(3-methylimidazole-1,3-diium-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-phenyl-2H-carbazol-2-ide;platinum |
| SMILES | C[N+]1=C=[N+](c2[c-]c(C3(c4[c-]cc5c(c4)c4ccccc4n5-c4[c-]cccc4)c4ccccc4-c4ccccc43)ccc2)C=C1.[Pt] |
| InChI | InChI=1S/C41H26N3.Pt/c1-42-24-25-43(28-42)32-15-11-12-29(26-32)41(37-19-8-5-16-33(37)34-17-6-9-20-38(34)41)30-22-23-40-36(27-30)35-18-7-10-21-39(35)44(40)31-13-3-2-4-14-31;/h2-13,15-21,23-25,27H,1H3;/q-1; |
| InChIKey | NMWACKJIAPLWPA-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 10.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.76 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|