C29H21N3Pt — CID 166011641
3-[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]methyl]-9-phenyl-2H-carbazol-2-ide;platinum(4+) (PubChem CID 166011641) has the molecular formula C29H21N3Pt and a molecular weight of 606.59 g/mol. Its IUPAC name is 3-[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]methyl]-9-phenyl-2H-carbazol-2-ide;platinum(4+).
| Compound Name | 3-[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]methyl]-9-phenyl-2H-carbazol-2-ide;platinum(4+) |
|---|---|
| PubChem CID | 166011641 |
| Molecular Formula | C29H21N3Pt |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | 3-[[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]methyl]-9-phenyl-2H-carbazol-2-ide;platinum(4+) |
| SMILES | CN1C=CN(c2[c-]c(Cc3[c-]cc4c(c3)c3ccccc3n4-c3[c-]cccc3)ccc2)[CH-]1.[Pt+4] |
| InChI | InChI=1S/C29H21N3.Pt/c1-30-16-17-31(21-30)25-11-7-8-22(19-25)18-23-14-15-29-27(20-23)26-12-5-6-13-28(26)32(29)24-9-3-2-4-10-24;/h2-9,11-13,15-17,20-21H,18H2,1H3;/q-4;+4 |
| InChIKey | YRWCDPNAASZVOR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|