C22H36O5 — CID 156679724
(7E,11Z,14Z)-5,6-dihydroxy-2,2-dimethyl-9-oxoicosa-7,11,14-trienoic acid (PubChem CID 156679724) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (7E,11Z,14Z)-5,6-dihydroxy-2,2-dimethyl-9-oxoicosa-7,11,14-trienoic acid.
| Compound Name | (7E,11Z,14Z)-5,6-dihydroxy-2,2-dimethyl-9-oxoicosa-7,11,14-trienoic acid |
|---|---|
| PubChem CID | 156679724 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (7E,11Z,14Z)-5,6-dihydroxy-2,2-dimethyl-9-oxoicosa-7,11,14-trienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CC(=O)/C=C/C(O)C(O)CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H36O5/c1-4-5-6-7-8-9-10-11-12-13-18(23)14-15-19(24)20(25)16-17-22(2,3)21(26)27/h8-9,11-12,14-15,19-20,24-25H,4-7,10,13,16-17H2,1-3H3,(H,26,27)/b9-8-,12-11-,15-14+ |
| InChIKey | LYZVMJYZRUADSR-YPAIXNQCSA-N |
| XLogP | 4.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|