C22H40O5 — CID 156679677
(8Z,11Z)-5,6,7-trihydroxy-2,2-dimethylicosa-8,11-dienoic acid (PubChem CID 156679677) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (8Z,11Z)-5,6,7-trihydroxy-2,2-dimethylicosa-8,11-dienoic acid.
| Compound Name | (8Z,11Z)-5,6,7-trihydroxy-2,2-dimethylicosa-8,11-dienoic acid |
|---|---|
| PubChem CID | 156679677 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (8Z,11Z)-5,6,7-trihydroxy-2,2-dimethylicosa-8,11-dienoic acid |
| SMILES | CCCCCCCC/C=C\C/C=C\C(O)C(O)C(O)CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H40O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(23)20(25)19(24)16-17-22(2,3)21(26)27/h11-12,14-15,18-20,23-25H,4-10,13,16-17H2,1-3H3,(H,26,27)/b12-11-,15-14- |
| InChIKey | CFCHXSMUIIVIMA-HDXUUTQWSA-N |
| XLogP | 4.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|