C16H32O2Si — CID 156686213
[(1Z,3E)-5,5-dimethoxypenta-1,3-dienyl]-tri(propan-2-yl)silane (PubChem CID 156686213) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is [(1Z,3E)-5,5-dimethoxypenta-1,3-dienyl]-tri(propan-2-yl)silane.
| Compound Name | [(1Z,3E)-5,5-dimethoxypenta-1,3-dienyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 156686213 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | [(1Z,3E)-5,5-dimethoxypenta-1,3-dienyl]-tri(propan-2-yl)silane |
| SMILES | COC(/C=C/C=C\[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C16H32O2Si/c1-13(2)19(14(3)4,15(5)6)12-10-9-11-16(17-7)18-8/h9-16H,1-8H3/b11-9+,12-10- |
| InChIKey | FPMBAEGBBSSLAX-IXIPZQGVSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|