C50H35N — CID 156687312
9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenyl-9-(9-phenyl-9H-fluoren-3-yl)fluoren-3-amine (PubChem CID 156687312) has the molecular formula C50H35N and a molecular weight of 654.87 g/mol. Its IUPAC name is 9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenyl-9-(9-phenyl-9H-fluoren-3-yl)fluoren-3-amine.
| Compound Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenyl-9-(9-phenyl-9H-fluoren-3-yl)fluoren-3-amine |
|---|---|
| PubChem CID | 156687312 |
| Molecular Formula | C50H35N |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenyl-9-(9-phenyl-9H-fluoren-3-yl)fluoren-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc4c(c3)-c3ccccc3C4c3ccccc3)c3ccccc3-c3cc(N(c4ccccc4)c4ccccc4)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C50H35N/c1-5-17-35(18-6-1)49-43-27-14-13-25-41(43)45-33-37(29-31-44(45)49)50(36-19-7-2-8-20-36)47-28-16-15-26-42(47)46-34-40(30-32-48(46)50)51(38-21-9-3-10-22-38)39-23-11-4-12-24-39/h1-34,49H/i2D,7D,8D,19D,20D |
| InChIKey | WEEMHZNGNVESRY-KNJNLBDSSA-N |
| XLogP | 12.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |