C61H42N2O — CID 156687405
9-dibenzofuran-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenyl-3-N-(4-phenylphenyl)fluorene-3,6-diamine (PubChem CID 156687405) has the molecular formula C61H42N2O and a molecular weight of 824.05 g/mol. Its IUPAC name is 9-dibenzofuran-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenyl-3-N-(4-phenylphenyl)fluorene-3,6-diamine.
| Compound Name | 9-dibenzofuran-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenyl-3-N-(4-phenylphenyl)fluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687405 |
| Molecular Formula | C61H42N2O |
| Molecular Weight | 824.05 g/mol |
| Exact Mass | 823.36 |
| IUPAC Name | 9-dibenzofuran-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenyl-3-N-(4-phenylphenyl)fluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc4c(c3)oc3ccccc34)c3ccc(N(c4ccccc4)c4ccccc4)cc3-c3cc(N(c4ccccc4)c4ccc(-c5ccccc5)cc4)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C61H42N2O/c1-6-18-43(19-7-1)44-30-33-50(34-31-44)63(49-26-14-5-15-27-49)52-36-39-58-56(42-52)55-41-51(62(47-22-10-3-11-23-47)48-24-12-4-13-25-48)35-38-57(55)61(58,45-20-8-2-9-21-45)46-32-37-54-53-28-16-17-29-59(53)64-60(54)40-46/h1-42H/i2D,8D,9D,20D,21D |
| InChIKey | KYNXWVOBGYRNBR-IVZNSAAQSA-N |
| XLogP | 16.56 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.05 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |