C11H16O2S — CID 15668866
2-tert-butylsulfonylbicyclo[2.2.1]hepta-2,5-diene (PubChem CID 15668866) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-tert-butylsulfonylbicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-tert-butylsulfonylbicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 15668866 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-tert-butylsulfonylbicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C)(C)S(=O)(=O)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C11H16O2S/c1-11(2,3)14(12,13)10-7-8-4-5-9(10)6-8/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | QQUIRZQVCSQUCX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|