C19H16Br2N4O3 — CID 156693000
2,4-bis(3-amino-5-bromofuro[2,3-c]pyridin-2-yl)pentan-3-one (PubChem CID 156693000) has the molecular formula C19H16Br2N4O3 and a molecular weight of 508.17 g/mol. Its IUPAC name is 2,4-bis(3-amino-5-bromofuro[2,3-c]pyridin-2-yl)pentan-3-one.
| Compound Name | 2,4-bis(3-amino-5-bromofuro[2,3-c]pyridin-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 156693000 |
| Molecular Formula | C19H16Br2N4O3 |
| Molecular Weight | 508.17 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | 2,4-bis(3-amino-5-bromofuro[2,3-c]pyridin-2-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1oc2cnc(Br)cc2c1N)c1oc2cnc(Br)cc2c1N |
| InChI | InChI=1S/C19H16Br2N4O3/c1-7(18-15(22)9-3-13(20)24-5-11(9)27-18)17(26)8(2)19-16(23)10-4-14(21)25-6-12(10)28-19/h3-8H,22-23H2,1-2H3 |
| InChIKey | HCLUAEGGMKGAEJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.17 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|