C21H16Br2F2N2O3 — CID 156693009
2,4-bis(3-amino-5-bromo-7-fluoro-1-benzofuran-2-yl)pentan-3-one (PubChem CID 156693009) has the molecular formula C21H16Br2F2N2O3 and a molecular weight of 542.17 g/mol. Its IUPAC name is 2,4-bis(3-amino-5-bromo-7-fluoro-1-benzofuran-2-yl)pentan-3-one.
| Compound Name | 2,4-bis(3-amino-5-bromo-7-fluoro-1-benzofuran-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 156693009 |
| Molecular Formula | C21H16Br2F2N2O3 |
| Molecular Weight | 542.17 g/mol |
| Exact Mass | 539.95 |
| IUPAC Name | 2,4-bis(3-amino-5-bromo-7-fluoro-1-benzofuran-2-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1oc2c(F)cc(Br)cc2c1N)c1oc2c(F)cc(Br)cc2c1N |
| InChI | InChI=1S/C21H16Br2F2N2O3/c1-7(18-15(26)11-3-9(22)5-13(24)20(11)29-18)17(28)8(2)19-16(27)12-4-10(23)6-14(25)21(12)30-19/h3-8H,26-27H2,1-2H3 |
| InChIKey | QNISRBHBANYYMF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.17 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |