About cumene;2-methyloxane
cumene;2-methyloxane (PubChem CID 156699052) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is cumene;2-methyloxane.
Molecular Properties
| Compound Name | cumene;2-methyloxane |
| PubChem CID | 156699052 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | cumene;2-methyloxane |
| SMILES | CC(C)c1ccccc1.CC1CCCCO1 |
| InChI | InChI=1S/C9H12.C6H12O/c1-8(2)9-6-4-3-5-7-9;1-6-4-2-3-5-7-6/h3-8H,1-2H3;6H,2-5H2,1H3 |
| InChIKey | YGANHQDRSGNGSV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;2-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;2-methyloxane?
The IUPAC name of cumene;2-methyloxane (CID 156699052) is cumene;2-methyloxane.
What is the SMILES notation for cumene;2-methyloxane?
The canonical SMILES for cumene;2-methyloxane is CC(C)c1ccccc1.CC1CCCCO1.
What is the InChIKey of cumene;2-methyloxane?
The InChIKey is YGANHQDRSGNGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H12O/c1-8(2)9-6-4-3-5-7-9;1-6-4-2-3-5-7-6/h3-8H,1-2H3;6H,2-5H2,1H3.
What are the key properties of cumene;2-methyloxane?
cumene;2-methyloxane has a molecular weight of 220.36 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;2-methyloxane is sourced from PubChem (CID 156699052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).