C17H12Br2N2O2 — CID 156701129
(1E,6E)-1,7-bis(5-bromo-3-pyridinyl)hepta-1,6-diene-3,5-dione (PubChem CID 156701129) has the molecular formula C17H12Br2N2O2 and a molecular weight of 436.10 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(5-bromo-3-pyridinyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(5-bromo-3-pyridinyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 156701129 |
| Molecular Formula | C17H12Br2N2O2 |
| Molecular Weight | 436.10 g/mol |
| Exact Mass | 433.93 |
| IUPAC Name | (1E,6E)-1,7-bis(5-bromo-3-pyridinyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1cncc(Br)c1)CC(=O)/C=C/c1cncc(Br)c1 |
| InChI | InChI=1S/C17H12Br2N2O2/c18-14-5-12(8-20-10-14)1-3-16(22)7-17(23)4-2-13-6-15(19)11-21-9-13/h1-6,8-11H,7H2/b3-1+,4-2+ |
| InChIKey | WRPWRMGXLCAYOU-ZPUQHVIOSA-N |
| XLogP | 4.26 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.10 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|