C25H27ClN2O2 — CID 156702415
cyclopropyl-[4-[4-(5-methylquinolin-7-yl)phenoxy]piperidin-1-yl]methanone;hydrochloride (PubChem CID 156702415) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is cyclopropyl-[4-[4-(5-methylquinolin-7-yl)phenoxy]piperidin-1-yl]methanone;hydrochloride.
| Compound Name | cyclopropyl-[4-[4-(5-methylquinolin-7-yl)phenoxy]piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 156702415 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | cyclopropyl-[4-[4-(5-methylquinolin-7-yl)phenoxy]piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cc1cc(-c2ccc(OC3CCN(C(=O)C4CC4)CC3)cc2)cc2ncccc12.Cl |
| InChI | InChI=1S/C25H26N2O2.ClH/c1-17-15-20(16-24-23(17)3-2-12-26-24)18-6-8-21(9-7-18)29-22-10-13-27(14-11-22)25(28)19-4-5-19;/h2-3,6-9,12,15-16,19,22H,4-5,10-11,13-14H2,1H3;1H |
| InChIKey | BCXFNFULFRLICU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |