C25H26N2O2 — CID 163996154
cyclopropyl-[4-[4-(3-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]methanone (PubChem CID 163996154) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is cyclopropyl-[4-[4-(3-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[4-(3-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163996154 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | cyclopropyl-[4-[4-(3-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]methanone |
| SMILES | Cc1cc2cc(-c3ccc(OC4CCN(C(=O)C5CC5)CC4)cc3)ccc2cn1 |
| InChI | InChI=1S/C25H26N2O2/c1-17-14-22-15-20(4-5-21(22)16-26-17)18-6-8-23(9-7-18)29-24-10-12-27(13-11-24)25(28)19-2-3-19/h4-9,14-16,19,24H,2-3,10-13H2,1H3 |
| InChIKey | UEWCUFRAPUOLQO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |