C27H30N2O2 — CID 153119674
3-cyclopropyl-1-[4-[4-(1-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]propan-1-one (PubChem CID 153119674) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-cyclopropyl-1-[4-[4-(1-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 3-cyclopropyl-1-[4-[4-(1-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 153119674 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-cyclopropyl-1-[4-[4-(1-methylisoquinolin-6-yl)phenoxy]piperidin-1-yl]propan-1-one |
| SMILES | Cc1nccc2cc(-c3ccc(OC4CCN(C(=O)CCC5CC5)CC4)cc3)ccc12 |
| InChI | InChI=1S/C27H30N2O2/c1-19-26-10-7-22(18-23(26)12-15-28-19)21-5-8-24(9-6-21)31-25-13-16-29(17-14-25)27(30)11-4-20-2-3-20/h5-10,12,15,18,20,25H,2-4,11,13-14,16-17H2,1H3 |
| InChIKey | VUPGCDHWGRJMNB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |