C18H23N3O5 — CID 95873697
(5S)-5-[3-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 95873697) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is (5S)-5-[3-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95873697 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (5S)-5-[3-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(OC2CCN(C(=O)CC[C@@H]3NC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O5/c1-25-12-2-4-13(5-3-12)26-14-8-10-21(11-9-14)16(22)7-6-15-17(23)20-18(24)19-15/h2-5,14-15H,6-11H2,1H3,(H2,19,20,23,24)/t15-/m0/s1 |
| InChIKey | RCLKRRZQIASXEP-HNNXBMFYSA-N |
| XLogP | 1.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|