C24H27ClN2O2 — CID 156702349
1-[4-[4-(6-methylquinolin-3-yl)phenoxy]piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 156702349) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-[4-[4-(6-methylquinolin-3-yl)phenoxy]piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 1-[4-[4-(6-methylquinolin-3-yl)phenoxy]piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 156702349 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[4-[4-(6-methylquinolin-3-yl)phenoxy]piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CCC(=O)N1CCC(Oc2ccc(-c3cnc4ccc(C)cc4c3)cc2)CC1.Cl |
| InChI | InChI=1S/C24H26N2O2.ClH/c1-3-24(27)26-12-10-22(11-13-26)28-21-7-5-18(6-8-21)20-15-19-14-17(2)4-9-23(19)25-16-20;/h4-9,14-16,22H,3,10-13H2,1-2H3;1H |
| InChIKey | QEQPDXCYVPAPTE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |