C24H23ClN2O2 — CID 175122744
1-[4-[4-(3-chloroisoquinolin-6-yl)phenoxy]piperidin-1-yl]cyclopropane-1-carbaldehyde (PubChem CID 175122744) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is 1-[4-[4-(3-chloroisoquinolin-6-yl)phenoxy]piperidin-1-yl]cyclopropane-1-carbaldehyde.
| Compound Name | 1-[4-[4-(3-chloroisoquinolin-6-yl)phenoxy]piperidin-1-yl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 175122744 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[4-[4-(3-chloroisoquinolin-6-yl)phenoxy]piperidin-1-yl]cyclopropane-1-carbaldehyde |
| SMILES | O=CC1(N2CCC(Oc3ccc(-c4ccc5cnc(Cl)cc5c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H23ClN2O2/c25-23-14-20-13-18(1-2-19(20)15-26-23)17-3-5-21(6-4-17)29-22-7-11-27(12-8-22)24(16-28)9-10-24/h1-6,13-16,22H,7-12H2 |
| InChIKey | RRZZUIMLFCYMCT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|