C22H21N7O2 — CID 156708717
(2E)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylimino]-N-(furo[3,2-c]pyridin-6-ylmethyl)-2-hydrazinylidenepropanamide (PubChem CID 156708717) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is (2E)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylimino]-N-(furo[3,2-c]pyridin-6-ylmethyl)-2-hydrazinylidenepropanamide.
| Compound Name | (2E)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylimino]-N-(furo[3,2-c]pyridin-6-ylmethyl)-2-hydrazinylidenepropanamide |
|---|---|
| PubChem CID | 156708717 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2E)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylimino]-N-(furo[3,2-c]pyridin-6-ylmethyl)-2-hydrazinylidenepropanamide |
| SMILES | N/N=C(\C=N\Cc1cn2cc(C3CC3)ccc2n1)C(=O)NCc1cc2occc2cn1 |
| InChI | InChI=1S/C22H21N7O2/c23-28-19(22(30)26-10-17-7-20-15(8-25-17)5-6-31-20)11-24-9-18-13-29-12-16(14-1-2-14)3-4-21(29)27-18/h3-8,11-14H,1-2,9-10,23H2,(H,26,30)/b24-11+,28-19+ |
| InChIKey | OFKDBTBALNEOAE-XXZBRMJPSA-N |
| XLogP | 2.55 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|