C24H30N8O — CID 175621974
(Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(4-carbamimidoyl-2,6-dimethylphenyl)methyl]prop-2-enamide (PubChem CID 175621974) has the molecular formula C24H30N8O and a molecular weight of 446.56 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(4-carbamimidoyl-2,6-dimethylphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(4-carbamimidoyl-2,6-dimethylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 175621974 |
| Molecular Formula | C24H30N8O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(4-carbamimidoyl-2,6-dimethylphenyl)methyl]prop-2-enamide |
| SMILES | [H]/N=C(\N)c1cc(C)c(CNC(=O)/C(N)=C/N(N)Cc2cn3cc(C4CC4)ccc3n2)c(C)c1 |
| InChI | InChI=1S/C24H30N8O/c1-14-7-18(23(26)27)8-15(2)20(14)9-29-24(33)21(25)13-32(28)12-19-11-31-10-17(16-3-4-16)5-6-22(31)30-19/h5-8,10-11,13,16H,3-4,9,12,25,28H2,1-2H3,(H3,26,27)(H,29,33)/b21-13- |
| InChIKey | ASEYINLGPROOBB-BKUYFWCQSA-N |
| XLogP | 1.90 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|