C16H21N5O — CID 175622793
(Z)-2-amino-1-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]pent-1-en-3-one (PubChem CID 175622793) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is (Z)-2-amino-1-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]pent-1-en-3-one.
| Compound Name | (Z)-2-amino-1-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]pent-1-en-3-one |
|---|---|
| PubChem CID | 175622793 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (Z)-2-amino-1-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]pent-1-en-3-one |
| SMILES | CCC(=O)/C(N)=C/N(N)Cc1cn2cc(C3CC3)ccc2n1 |
| InChI | InChI=1S/C16H21N5O/c1-2-15(22)14(17)10-21(18)9-13-8-20-7-12(11-3-4-11)5-6-16(20)19-13/h5-8,10-11H,2-4,9,17-18H2,1H3/b14-10- |
| InChIKey | ORDNXAMILOSAOP-UVTDQMKNSA-N |
| XLogP | 1.67 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|