C22H24BrFN6O2 — CID 156708594
(Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(6-bromo-2-fluoro-3-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 156708594) has the molecular formula C22H24BrFN6O2 and a molecular weight of 503.38 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(6-bromo-2-fluoro-3-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(6-bromo-2-fluoro-3-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 156708594 |
| Molecular Formula | C22H24BrFN6O2 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(6-bromo-2-fluoro-3-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(Br)c(CNC(=O)/C(N)=C/N(N)Cc2cn3cc(C4CC4)ccc3n2)c1F |
| InChI | InChI=1S/C22H24BrFN6O2/c1-32-19-6-5-17(23)16(21(19)24)8-27-22(31)18(25)12-30(26)11-15-10-29-9-14(13-2-3-13)4-7-20(29)28-15/h4-7,9-10,12-13H,2-3,8,11,25-26H2,1H3,(H,27,31)/b18-12- |
| InChIKey | ZACUVQRQMUNHOG-PDGQHHTCSA-N |
| XLogP | 2.91 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|