C26H33FN8O2 — CID 165131042
(Z)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-N-[[6-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-fluoro-3-methoxyphenyl]methyl]-2-hydrazinylprop-2-enamide;molecular hydrogen (PubChem CID 165131042) has the molecular formula C26H33FN8O2 and a molecular weight of 508.60 g/mol. Its IUPAC name is (Z)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-N-[[6-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-fluoro-3-methoxyphenyl]methyl]-2-hydrazinylprop-2-enamide;molecular hydrogen.
| Compound Name | (Z)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-N-[[6-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-fluoro-3-methoxyphenyl]methyl]-2-hydrazinylprop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 165131042 |
| Molecular Formula | C26H33FN8O2 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (Z)-3-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methylamino]-N-[[6-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2-fluoro-3-methoxyphenyl]methyl]-2-hydrazinylprop-2-enamide;molecular hydrogen |
| SMILES | COc1ccc(C(/C=C\N)=C/N)c(CNC(=O)/C(=C/NCc2cn3cc(C4CC4)ccc3n2)NN)c1F.[H][H] |
| InChI | InChI=1S/C26H31FN8O2.H2/c1-37-23-6-5-20(17(10-29)8-9-28)21(25(23)27)12-32-26(36)22(34-30)13-31-11-19-15-35-14-18(16-2-3-16)4-7-24(35)33-19;/h4-10,13-16,31,34H,2-3,11-12,28-30H2,1H3,(H,32,36);1H/b9-8-,17-10+,22-13-; |
| InChIKey | HJHJUGIIGMLKBK-VSTPUEHJSA-N |
| XLogP | 2.09 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|