C26H28FN7O4 — CID 156708649
3-[2-[[amino-[(Z)-2-amino-3-[(6-cyano-2-fluoro-3-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]amino]methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]propanoic acid (PubChem CID 156708649) has the molecular formula C26H28FN7O4 and a molecular weight of 521.55 g/mol. Its IUPAC name is 3-[2-[[amino-[(Z)-2-amino-3-[(6-cyano-2-fluoro-3-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]amino]methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]propanoic acid.
| Compound Name | 3-[2-[[amino-[(Z)-2-amino-3-[(6-cyano-2-fluoro-3-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]amino]methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 156708649 |
| Molecular Formula | C26H28FN7O4 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 3-[2-[[amino-[(Z)-2-amino-3-[(6-cyano-2-fluoro-3-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]amino]methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]propanoic acid |
| SMILES | COc1ccc(C#N)c(CNC(=O)/C(N)=C/N(N)Cc2cn3cc(C4CC4)cc(CCC(=O)O)c3n2)c1F |
| InChI | InChI=1S/C26H28FN7O4/c1-38-22-6-4-17(9-28)20(24(22)27)10-31-26(37)21(29)14-34(30)13-19-12-33-11-18(15-2-3-15)8-16(25(33)32-19)5-7-23(35)36/h4,6,8,11-12,14-15H,2-3,5,7,10,13,29-30H2,1H3,(H,31,37)(H,35,36)/b21-14- |
| InChIKey | XZPPOVCAHPBQSE-STZFKDTASA-N |
| XLogP | 2.04 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|