C17H24BrN5O2 — CID 153344026
(Z)-1-[amino-[(8-bromo-6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-1-en-2-amine;ethyl formate (PubChem CID 153344026) has the molecular formula C17H24BrN5O2 and a molecular weight of 410.32 g/mol. Its IUPAC name is (Z)-1-[amino-[(8-bromo-6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-1-en-2-amine;ethyl formate.
| Compound Name | (Z)-1-[amino-[(8-bromo-6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-1-en-2-amine;ethyl formate |
|---|---|
| PubChem CID | 153344026 |
| Molecular Formula | C17H24BrN5O2 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (Z)-1-[amino-[(8-bromo-6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-1-en-2-amine;ethyl formate |
| SMILES | C/C(N)=C/N(N)Cc1cn2cc(C3CC3)cc(Br)c2n1.CCOC=O |
| InChI | InChI=1S/C14H18BrN5.C3H6O2/c1-9(16)5-20(17)8-12-7-19-6-11(10-2-3-10)4-13(15)14(19)18-12;1-2-5-3-4/h4-7,10H,2-3,8,16-17H2,1H3;3H,2H2,1H3/b9-5-; |
| InChIKey | BTUPKUPNCHCMFX-UYTGOYFPSA-N |
| XLogP | 2.65 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|