C24H31N8O2P — CID 153343842
(Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal;1-(methylaminomethyl)-8-phosphanylimidazo[1,5-a]pyridin-7-ol (PubChem CID 153343842) has the molecular formula C24H31N8O2P and a molecular weight of 494.54 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal;1-(methylaminomethyl)-8-phosphanylimidazo[1,5-a]pyridin-7-ol.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal;1-(methylaminomethyl)-8-phosphanylimidazo[1,5-a]pyridin-7-ol |
|---|---|
| PubChem CID | 153343842 |
| Molecular Formula | C24H31N8O2P |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methylimidazo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal;1-(methylaminomethyl)-8-phosphanylimidazo[1,5-a]pyridin-7-ol |
| SMILES | CNCc1ncn2ccc(O)c(P)c12.Cc1cc(C2CC2)cn2cc(CN(N)/C=C(\N)C=O)nc12 |
| InChI | InChI=1S/C15H19N5O.C9H12N3OP/c1-10-4-12(11-2-3-11)5-19-7-14(18-15(10)19)8-20(17)6-13(16)9-21;1-10-4-6-8-9(14)7(13)2-3-12(8)5-11-6/h4-7,9,11H,2-3,8,16-17H2,1H3;2-3,5,10,13H,4,14H2,1H3/b13-6-; |
| InChIKey | NSLNNGVSLNCNBC-FJMCHERXSA-N |
| XLogP | 1.45 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|