C15H19BN4O — CID 153343641
(Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methyl-[1,3]azaborolo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal (PubChem CID 153343641) has the molecular formula C15H19BN4O and a molecular weight of 282.16 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methyl-[1,3]azaborolo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methyl-[1,3]azaborolo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal |
|---|---|
| PubChem CID | 153343641 |
| Molecular Formula | C15H19BN4O |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropyl-8-methyl-[1,3]azaborolo[1,2-a]pyridin-2-yl)methyl]amino]prop-2-enal |
| SMILES | Cc1cc(C2CC2)cn2cc(CN(N)/C=C(\N)C=O)bc12 |
| InChI | InChI=1S/C15H19BN4O/c1-10-4-12(11-2-3-11)5-19-6-13(16-15(10)19)7-20(18)8-14(17)9-21/h4-6,8-9,11H,2-3,7,17-18H2,1H3/b14-8- |
| InChIKey | CVUJOVBWCMHNAR-ZSOIEALJSA-N |
| XLogP | 1.14 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|