C21H26N8O — CID 165131278
(Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-(3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-6-yl)prop-2-enamide (PubChem CID 165131278) has the molecular formula C21H26N8O and a molecular weight of 406.49 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-(3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-(3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 165131278 |
| Molecular Formula | C21H26N8O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-(3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-6-yl)prop-2-enamide |
| SMILES | Cc1[nH]nc2c1CCC2NC(=O)/C(N)=C/N(N)Cc1cn2cc(C3CC3)ccc2n1 |
| InChI | InChI=1S/C21H26N8O/c1-12-16-5-6-18(20(16)27-26-12)25-21(30)17(22)11-29(23)10-15-9-28-8-14(13-2-3-13)4-7-19(28)24-15/h4,7-9,11,13,18H,2-3,5-6,10,22-23H2,1H3,(H,25,30)(H,26,27)/b17-11- |
| InChIKey | KEXSTUXLOPBPCQ-BOPFTXTBSA-N |
| XLogP | 1.52 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|