C22H23FN8O2 — CID 156708832
(Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(5-cyano-3-fluoro-2-methoxy-4-pyridinyl)methyl]prop-2-enamide (PubChem CID 156708832) has the molecular formula C22H23FN8O2 and a molecular weight of 450.48 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(5-cyano-3-fluoro-2-methoxy-4-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(5-cyano-3-fluoro-2-methoxy-4-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 156708832 |
| Molecular Formula | C22H23FN8O2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (Z)-2-amino-3-[amino-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]amino]-N-[(5-cyano-3-fluoro-2-methoxy-4-pyridinyl)methyl]prop-2-enamide |
| SMILES | COc1ncc(C#N)c(CNC(=O)/C(N)=C/N(N)Cc2cn3cc(C4CC4)ccc3n2)c1F |
| InChI | InChI=1S/C22H23FN8O2/c1-33-22-20(23)17(15(6-24)7-28-22)8-27-21(32)18(25)12-31(26)11-16-10-30-9-14(13-2-3-13)4-5-19(30)29-16/h4-5,7,9-10,12-13H,2-3,8,11,25-26H2,1H3,(H,27,32)/b18-12- |
| InChIKey | BXFJHLDHBDDPFB-PDGQHHTCSA-N |
| XLogP | 1.42 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|