C19H28N2O3 — CID 156711933
ethane;2-methyl-5-propan-2-yl-3H-isoindol-1-one;piperidine-2,6-dione (PubChem CID 156711933) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is ethane;2-methyl-5-propan-2-yl-3H-isoindol-1-one;piperidine-2,6-dione.
| Compound Name | ethane;2-methyl-5-propan-2-yl-3H-isoindol-1-one;piperidine-2,6-dione |
|---|---|
| PubChem CID | 156711933 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | ethane;2-methyl-5-propan-2-yl-3H-isoindol-1-one;piperidine-2,6-dione |
| SMILES | CC.CC(C)c1ccc2c(c1)CN(C)C2=O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C12H15NO.C5H7NO2.C2H6/c1-8(2)9-4-5-11-10(6-9)7-13(3)12(11)14;7-4-2-1-3-5(8)6-4;1-2/h4-6,8H,7H2,1-3H3;1-3H2,(H,6,7,8);1-2H3 |
| InChIKey | NKLPDAVLZYNJFM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|